CAS 2227989-58-2 is the registry number for N-Neopentylammelide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-(2,2-dimethylpropylamino)-1H-1,3,5-triazine-2,4-dione (CAS 2227989-58-2) is a chemical compound with the molecular formula C8H14N4O2 and a molecular weight of 198.22 g/mol. IUPAC name: 6-(2,2-dimethylpropylamino)-1H-1,3,5-triazine-2,4-dione. InChIKey: NNTGXVJZNOSNQZ-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 6-(2,2-dimethylpropylamino)-1H-1,3,5-triazine-2,4-dione |
| InChIKey | NNTGXVJZNOSNQZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CNC1=NC(=O)NC(=O)N1 |
Computed by PubChem (NCBI)