CAS 1808408-69-6 is the registry number for (1-((3R,4S)-4-Methoxytetrahydrofuran-3-yl)-1H-1,2,3-triazol-4-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine (CAS 1808408-69-6) is a chemical compound with the molecular formula C8H14N4O2 and a molecular weight of 198.22 g/mol. IUPAC name: [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine. InChIKey: DIFOQOVHIIKTLT-HTQZYQBOSA-N.
| Molecular formula | C8H14N4O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine |
| InChIKey | DIFOQOVHIIKTLT-HTQZYQBOSA-N |
| SMILES | CO[C@@H]1COC[C@H]1N2C=C(N=N2)CN |
Computed by PubChem (NCBI)