CAS 1178903-96-2 is the registry number for Cyclophosphamide-d8. Offered by: Hubei YoungXin, Chemat Brand, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 1 mg.
N,N-bis(2-chloro-1,1,2,2-tetradeuterioethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine (CAS 1178903-96-2) is a chemical compound with the molecular formula C7H15Cl2N2O2P and a molecular weight of 269.13 g/mol. IUPAC name: N,N-bis(2-chloro-1,1,2,2-tetradeuterioethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine. InChIKey: CMSMOCZEIVJLDB-LYQYTLMISA-N.
| Molecular formula | C7H15Cl2N2O2P |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | N,N-bis(2-chloro-1,1,2,2-tetradeuterioethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine |
| InChIKey | CMSMOCZEIVJLDB-LYQYTLMISA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])Cl)N(C([2H])([2H])C([2H])([2H])Cl)P1(=O)NCCCO1 |
Computed by PubChem (NCBI)