CAS 66849-34-1 is the registry number for (R)-Ifosfamide. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-N,3-bis(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine (CAS 66849-34-1) is a chemical compound with the molecular formula C7H15Cl2N2O2P and a molecular weight of 261.08 g/mol. IUPAC name: (2R)-N,3-bis(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine. InChIKey: HOMGKSMUEGBAAB-CQSZACIVSA-N.
| Molecular formula | C7H15Cl2N2O2P |
|---|---|
| Molecular weight | 261.08 g/mol |
| IUPAC name | (2R)-N,3-bis(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine |
| InChIKey | HOMGKSMUEGBAAB-CQSZACIVSA-N |
| SMILES | C1CN([P@](=O)(OC1)NCCCl)CCCl |
Computed by PubChem (NCBI)