CAS 173547-45-0 appears in our catalog under these names: Cyclophosphamide-d4, Cyclophosphamide-d4, >95% (HPLC), Cyclophosphamide–d4, Cyclophosphamide-d4, 99.46%. Offered by: Hubei YoungXin, TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 1 mg.
N,N-bis(2-chloroethyl)-4,4,6,6-tetradeuterio-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine (CAS 173547-45-0) is a chemical compound with the molecular formula C7H15Cl2N2O2P and a molecular weight of 265.11 g/mol. IUPAC name: N,N-bis(2-chloroethyl)-4,4,6,6-tetradeuterio-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine. InChIKey: CMSMOCZEIVJLDB-CTVJKLEYSA-N.
| Molecular formula | C7H15Cl2N2O2P |
|---|---|
| Molecular weight | 265.11 g/mol |
| IUPAC name | N,N-bis(2-chloroethyl)-4,4,6,6-tetradeuterio-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine |
| InChIKey | CMSMOCZEIVJLDB-CTVJKLEYSA-N |
| SMILES | [2H]C1(CC(OP(=O)(N1)N(CCCl)CCCl)([2H])[2H])[2H] |
Computed by PubChem (NCBI)