CAS 1178953-47-3 is the registry number for 2–Methyl–2–propanyl 4–(4–bromophenyl)–3–oxo–1–piperazinecarboxylate. Offered by: GLPBio. Available pack sizes: 100mg.
Tert-butyl 4-(4-bromophenyl)-3-oxopiperazine-1-carboxylate (CAS 1178953-47-3) is a chemical compound with the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. IUPAC name: tert-butyl 4-(4-bromophenyl)-3-oxopiperazine-1-carboxylate. InChIKey: OGZRSWMPPWOOMT-UHFFFAOYSA-N.
| Molecular formula | C15H19BrN2O3 |
|---|---|
| Molecular weight | 355.23 g/mol |
| IUPAC name | tert-butyl 4-(4-bromophenyl)-3-oxopiperazine-1-carboxylate |
| InChIKey | OGZRSWMPPWOOMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)