Products 1824073-95-1
CAS 1824073-95-1 is the registry number for tert-Butyl 4-(2-bromophenyl)-3-oxopiperazine-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 4-(2-bromophenyl)-3-oxopiperazine-1-carboxylate (CAS 1824073-95-1) is a chemical compound with the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. IUPAC name: tert-butyl 4-(2-bromophenyl)-3-oxopiperazine-1-carboxylate. InChIKey: SBEQDCVPRYLIHZ-UHFFFAOYSA-N.
| Molecular formula | C15H19BrN2O3 |
|---|---|
| Molecular weight | 355.23 g/mol |
| IUPAC name | tert-butyl 4-(2-bromophenyl)-3-oxopiperazine-1-carboxylate |
| InChIKey | SBEQDCVPRYLIHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)C1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)