Products 1955492-82-6
CAS 1955492-82-6 is the registry number for tert-Butyl 2-(3-bromophenyl)-3-oxopiperazine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 2-(3-bromophenyl)-3-oxopiperazine-1-carboxylate (CAS 1955492-82-6) is a chemical compound with the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. IUPAC name: tert-butyl 2-(3-bromophenyl)-3-oxopiperazine-1-carboxylate. InChIKey: PQYCJMUNEVALQL-UHFFFAOYSA-N.
| Molecular formula | C15H19BrN2O3 |
|---|---|
| Molecular weight | 355.23 g/mol |
| IUPAC name | tert-butyl 2-(3-bromophenyl)-3-oxopiperazine-1-carboxylate |
| InChIKey | PQYCJMUNEVALQL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(=O)C1C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)