Products 117903-53-4
CAS 117903-53-4 is the registry number for meso-1,2-Bis(4-bromophenyl)ethanediamine, 98+%. Offered by: Thermo Scientific (Acros). Available pack sizes: 100MG.
1,2-bis(4-bromophenyl)ethane-1,1-diamine (CAS 117903-53-4) is a chemical compound with the molecular formula C14H14Br2N2 and a molecular weight of 370.08 g/mol. IUPAC name: 1,2-bis(4-bromophenyl)ethane-1,1-diamine. InChIKey: GANMXFWDVICUEK-UHFFFAOYSA-N.
| Molecular formula | C14H14Br2N2 |
|---|---|
| Molecular weight | 370.08 g/mol |
| IUPAC name | 1,2-bis(4-bromophenyl)ethane-1,1-diamine |
| InChIKey | GANMXFWDVICUEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C2=CC=C(C=C2)Br)(N)N)Br |
Computed by PubChem (NCBI)