CAS 1179057-31-8 appears in our catalog under these names: 4-Chloro-2-(methoxymethyl)-5-phenylthieno(2,3-d)pyrimidine, 95%, 4-Chloro-2-(methoxymethyl)-5-phenylthieno(2,3-d)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-chloro-2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidine (CAS 1179057-31-8) is a chemical compound with the molecular formula C14H11ClN2OS and a molecular weight of 290.8 g/mol. IUPAC name: 4-chloro-2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidine. InChIKey: LGEYDTOXPHBQJZ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2OS |
|---|---|
| Molecular weight | 290.8 g/mol |
| IUPAC name | 4-chloro-2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidine |
| InChIKey | LGEYDTOXPHBQJZ-UHFFFAOYSA-N |
| SMILES | COCC1=NC2=C(C(=CS2)C3=CC=CC=C3)C(=N1)Cl |
Computed by PubChem (NCBI)