CAS 554436-89-4 is the registry number for 2-(Chloromethyl)-6-methyl-5-phenyl-3H,4H-thieno(2,3-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(chloromethyl)-6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 554436-89-4) is a chemical compound with the molecular formula C14H11ClN2OS and a molecular weight of 290.8 g/mol. IUPAC name: 2-(chloromethyl)-6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: BQSWUMCOPXLJJR-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2OS |
|---|---|
| Molecular weight | 290.8 g/mol |
| IUPAC name | 2-(chloromethyl)-6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | BQSWUMCOPXLJJR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(S1)N=C(NC2=O)CCl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)