Products 862975-80-2
CAS 862975-80-2 is the registry number for N-(3-Chlorophenyl)-6-methoxy-1,3-benzothiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(3-chlorophenyl)-6-methoxy-1,3-benzothiazol-2-amine (CAS 862975-80-2) is a chemical compound with the molecular formula C14H11ClN2OS and a molecular weight of 290.8 g/mol. IUPAC name: N-(3-chlorophenyl)-6-methoxy-1,3-benzothiazol-2-amine. InChIKey: BVWISFXMUOKOIB-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2OS |
|---|---|
| Molecular weight | 290.8 g/mol |
| IUPAC name | N-(3-chlorophenyl)-6-methoxy-1,3-benzothiazol-2-amine |
| InChIKey | BVWISFXMUOKOIB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(S2)NC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)