CAS 1179220-59-7 appears in our catalog under these names: 2-Chloro-5-(3,3-dimethylbutanamido)benzoic acid, 95%, 2-Chloro-5-(3,3-dimethylbutanamido)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-5-(3,3-dimethylbutanoylamino)benzoic acid (CAS 1179220-59-7) is a chemical compound with the molecular formula C13H16ClNO3 and a molecular weight of 269.72 g/mol. IUPAC name: 2-chloro-5-(3,3-dimethylbutanoylamino)benzoic acid. InChIKey: BWQMJNZRJJUODF-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO3 |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 2-chloro-5-(3,3-dimethylbutanoylamino)benzoic acid |
| InChIKey | BWQMJNZRJJUODF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)NC1=CC(=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)