Products 1179243-44-7

CAS 1179243-44-7 is the registry number for 2-(3-Methoxypropoxy)-4-propoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(3-methoxypropoxy)-4-propoxybenzoic acid (CAS 1179243-44-7) is a chemical compound with the molecular formula C14H20O5 and a molecular weight of 268.30 g/mol. IUPAC name: 2-(3-methoxypropoxy)-4-propoxybenzoic acid. InChIKey: WHHAHBPWUJTQAG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20O5
Molecular weight268.30 g/mol
IUPAC name2-(3-methoxypropoxy)-4-propoxybenzoic acid
InChIKeyWHHAHBPWUJTQAG-UHFFFAOYSA-N
SMILESCCCOC1=CC(=C(C=C1)C(=O)O)OCCCOC

Computed by PubChem (NCBI)