CAS 127457-63-0 appears in our catalog under these names: 3-{2-[2-(Benzyloxy)ethoxy]ethoxy}propanoic acid, 98%, Benzyl–PEG3–acid, 3-(2-(2-(Benzyloxy)ethoxy)ethoxy)propanoic acid, 97%, 97%, Benzyl-PEG3-acid, 97.0%, BENZYL-PEG3-ACID, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 100mg, 5g, 250 mg, 1 g, 5 g.
3-[2-(2-phenylmethoxyethoxy)ethoxy]propanoic acid (CAS 127457-63-0) is a chemical compound with the molecular formula C14H20O5 and a molecular weight of 268.30 g/mol. IUPAC name: 3-[2-(2-phenylmethoxyethoxy)ethoxy]propanoic acid. InChIKey: QCNCDLBZNNIXAQ-UHFFFAOYSA-N.
| Molecular formula | C14H20O5 |
|---|---|
| Molecular weight | 268.30 g/mol |
| IUPAC name | 3-[2-(2-phenylmethoxyethoxy)ethoxy]propanoic acid |
| InChIKey | QCNCDLBZNNIXAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)