CAS 75336-82-2 is the registry number for Methyl 3-O-benzyl-a-L-rhamnopyranoside. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 5g, 2g.
(2R,3R,4R,5S,6S)-2-methoxy-6-methyl-4-phenylmethoxyoxane-3,5-diol (CAS 75336-82-2) is a chemical compound with the molecular formula C14H20O5 and a molecular weight of 268.30 g/mol. IUPAC name: (2R,3R,4R,5S,6S)-2-methoxy-6-methyl-4-phenylmethoxyoxane-3,5-diol. InChIKey: YKNDWBCLABIQAZ-DDNMXHNFSA-N.
| Molecular formula | C14H20O5 |
|---|---|
| Molecular weight | 268.30 g/mol |
| IUPAC name | (2R,3R,4R,5S,6S)-2-methoxy-6-methyl-4-phenylmethoxyoxane-3,5-diol |
| InChIKey | YKNDWBCLABIQAZ-DDNMXHNFSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC)O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)