CAS 1179348-74-3 is the registry number for 1-ethyl-2,3-dihydro-1H-indole-6-carbaldehyde, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxopiperidine-1-carboxylate (CAS 1179348-74-3) is a chemical compound with the molecular formula C16H31NO4Si and a molecular weight of 329.51 g/mol. IUPAC name: tert-butyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxopiperidine-1-carboxylate. InChIKey: UIIIAHUXNIKHEH-CYBMUJFWSA-N.
| Molecular formula | C16H31NO4Si |
|---|---|
| Molecular weight | 329.51 g/mol |
| IUPAC name | tert-butyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxopiperidine-1-carboxylate |
| InChIKey | UIIIAHUXNIKHEH-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](CC(=O)C1)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)