CAS 134441-71-7 is the registry number for (2S,4R)-tert-Butyl 4-((tert-butyldimethylsilyl)oxy)-2-formylpyrrolidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 5g, 1g.
Tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpyrrolidine-1-carboxylate (CAS 134441-71-7) is a chemical compound with the molecular formula C16H31NO4Si and a molecular weight of 329.51 g/mol. IUPAC name: tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpyrrolidine-1-carboxylate. InChIKey: FUDKXBTUIHSMIL-QWHCGFSZSA-N.
| Molecular formula | C16H31NO4Si |
|---|---|
| Molecular weight | 329.51 g/mol |
| IUPAC name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpyrrolidine-1-carboxylate |
| InChIKey | FUDKXBTUIHSMIL-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C=O)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)