Products 2386509-89-1
CAS 2386509-89-1 is the registry number for tert-Butyl 3-(tert-butyldimethylsilyloxy)-4-oxopiperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
Tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-4-oxopiperidine-1-carboxylate (CAS 2386509-89-1) is a chemical compound with the molecular formula C16H31NO4Si and a molecular weight of 329.51 g/mol. IUPAC name: tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-4-oxopiperidine-1-carboxylate. InChIKey: WOIIDTCHTCGVFO-UHFFFAOYSA-N.
| Molecular formula | C16H31NO4Si |
|---|---|
| Molecular weight | 329.51 g/mol |
| IUPAC name | tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-4-oxopiperidine-1-carboxylate |
| InChIKey | WOIIDTCHTCGVFO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(C1)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)