CAS 117964-21-3 appears in our catalog under these names: 1,2,3,5-tetrabromo-4-(2,3,4,6-tetrabromophenoxy)benzene, PBDE 197 (>85%), PBDE No. 197, PBDE 197. Offered by: Hubei YoungXin, TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
1,2,3,5-tetrabromo-4-(2,3,4,6-tetrabromophenoxy)benzene (CAS 117964-21-3) is a chemical compound with the molecular formula C12H2Br8O and a molecular weight of 801.4 g/mol. IUPAC name: 1,2,3,5-tetrabromo-4-(2,3,4,6-tetrabromophenoxy)benzene. InChIKey: AAFUUKPTSPVXJH-UHFFFAOYSA-N.
| Molecular formula | C12H2Br8O |
|---|---|
| Molecular weight | 801.4 g/mol |
| IUPAC name | 1,2,3,5-tetrabromo-4-(2,3,4,6-tetrabromophenoxy)benzene |
| InChIKey | AAFUUKPTSPVXJH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)Br)OC2=C(C(=C(C=C2Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)