CAS 446255-39-6 is the registry number for 2,2',3,3',4,4',5,6'-Octabromodiphenyl Ether, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
1,2,3,4-tetrabromo-5-(2,3,4,6-tetrabromophenoxy)benzene (CAS 446255-39-6) is a chemical compound with the molecular formula C12H2Br8O and a molecular weight of 801.4 g/mol. IUPAC name: 1,2,3,4-tetrabromo-5-(2,3,4,6-tetrabromophenoxy)benzene. InChIKey: IEWFKOVTVJNWFF-UHFFFAOYSA-N.
| Molecular formula | C12H2Br8O |
|---|---|
| Molecular weight | 801.4 g/mol |
| IUPAC name | 1,2,3,4-tetrabromo-5-(2,3,4,6-tetrabromophenoxy)benzene |
| InChIKey | IEWFKOVTVJNWFF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)Br)Br)OC2=C(C(=C(C=C2Br)Br)Br)Br |
Computed by PubChem (NCBI)