CAS 446255-54-5 appears in our catalog under these names: PBDE 204, PBDE No. 204, 2,2',3,4,4',5,6,6'-Octabromodiphenyl ether. Offered by: TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 25mg, 5mg, 50mg, 100mg.
1,2,3,4,5-pentabromo-6-(2,4,6-tribromophenoxy)benzene (CAS 446255-54-5) is a chemical compound with the molecular formula C12H2Br8O and a molecular weight of 801.4 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-(2,4,6-tribromophenoxy)benzene. InChIKey: YZABCBOJTHQTSX-UHFFFAOYSA-N.
| Molecular formula | C12H2Br8O |
|---|---|
| Molecular weight | 801.4 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-(2,4,6-tribromophenoxy)benzene |
| InChIKey | YZABCBOJTHQTSX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)OC2=C(C(=C(C(=C2Br)Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)