CAS 1179761-73-9 is the registry number for 4-(1,3-Benzoxazol-2-yloxy)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(1,3-benzoxazol-2-yloxy)aniline (CAS 1179761-73-9) is a chemical compound with the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. IUPAC name: 4-(1,3-benzoxazol-2-yloxy)aniline. InChIKey: MCQYHZVIZDWZLQ-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 4-(1,3-benzoxazol-2-yloxy)aniline |
| InChIKey | MCQYHZVIZDWZLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)OC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)