Products 1179918-36-5

CAS 1179918-36-5 appears in our catalog under these names: 5-Methyl-1H-pyrazole-4-sulfonyl chloride, 98%, 98%, 5-Methyl-1H-pyrazole-4-sulfonyl chloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5-methyl-1H-pyrazole-4-sulfonyl chloride (CAS 1179918-36-5) is a chemical compound with the molecular formula C4H5ClN2O2S and a molecular weight of 180.61 g/mol. IUPAC name: 5-methyl-1H-pyrazole-4-sulfonyl chloride. InChIKey: HAIPHBVEKLIHCB-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5ClN2O2S
Molecular weight180.61 g/mol
IUPAC name5-methyl-1H-pyrazole-4-sulfonyl chloride
InChIKeyHAIPHBVEKLIHCB-UHFFFAOYSA-N
SMILESCC1=C(C=NN1)S(=O)(=O)Cl

Computed by PubChem (NCBI)