Products 2167622-42-4

CAS 2167622-42-4 is the registry number for 5-Methyl-1H-imidazole-4-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

5-methyl-1H-imidazole-4-sulfonyl chloride (CAS 2167622-42-4) is a chemical compound with the molecular formula C4H5ClN2O2S and a molecular weight of 180.61 g/mol. IUPAC name: 5-methyl-1H-imidazole-4-sulfonyl chloride. InChIKey: KJHNMPGYUKTZSC-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5ClN2O2S
Molecular weight180.61 g/mol
IUPAC name5-methyl-1H-imidazole-4-sulfonyl chloride
InChIKeyKJHNMPGYUKTZSC-UHFFFAOYSA-N
SMILESCC1=C(N=CN1)S(=O)(=O)Cl

Computed by PubChem (NCBI)