Products 55694-81-0

CAS 55694-81-0 appears in our catalog under these names: 1-Methyl-1h-imidazole-2-sulfonyl chloride, 95%, 1-Methylimidazole-2-sulfonyl chloride, 1-METHYLIMIDAZOLE-2-SULFONYL CHLORIDE, &. Offered by: Combi-blocks, Biosynth, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 0,5g.

Structural formula: {0} (CAS {1})

1-methylimidazole-2-sulfonyl chloride (CAS 55694-81-0) is a chemical compound with the molecular formula C4H5ClN2O2S and a molecular weight of 180.61 g/mol. IUPAC name: 1-methylimidazole-2-sulfonyl chloride. InChIKey: VIGPKJYEYGGCLK-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5ClN2O2S
Molecular weight180.61 g/mol
IUPAC name1-methylimidazole-2-sulfonyl chloride
InChIKeyVIGPKJYEYGGCLK-UHFFFAOYSA-N
SMILESCN1C=CN=C1S(=O)(=O)Cl

Computed by PubChem (NCBI)