Products 1179946-02-1
CAS 1179946-02-1 is the registry number for 6-Amino-1-(2,2-difluoroethyl)-1,2,3,4-tetrahydroquinolin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-amino-1-(2,2-difluoroethyl)-3,4-dihydroquinolin-2-one (CAS 1179946-02-1) is a chemical compound with the molecular formula C11H12F2N2O and a molecular weight of 226.22 g/mol. IUPAC name: 6-amino-1-(2,2-difluoroethyl)-3,4-dihydroquinolin-2-one. InChIKey: DAIDXOQCCJTAAG-UHFFFAOYSA-N.
| Molecular formula | C11H12F2N2O |
|---|---|
| Molecular weight | 226.22 g/mol |
| IUPAC name | 6-amino-1-(2,2-difluoroethyl)-3,4-dihydroquinolin-2-one |
| InChIKey | DAIDXOQCCJTAAG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C2=C1C=C(C=C2)N)CC(F)F |
Computed by PubChem (NCBI)