CAS 118-97-8 appears in our catalog under these names: 4-Chloro-3,5-dinitrobenzoic acid, 97% , 4-Chloro-3,5-dinitrobenzoic acid, 95%, 4–Chloro–3,5–dinitrobenzoic Acid, 4-Chloro-3,5-dinitrobenzoic Acid, >98.0%(T), 4-Chloro-3,5-dinitrobenzoic acid. Offered by: Thermo Scientific (Alfa Aesar), Combi-blocks, GLPBio, TCI, Biosynth. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, 250g, 0,5kg, 2kg.
4-chloro-3,5-dinitrobenzoic acid (CAS 118-97-8) is a chemical compound with the molecular formula C7H3ClN2O6 and a molecular weight of 246.56 g/mol. IUPAC name: 4-chloro-3,5-dinitrobenzoic acid. InChIKey: PCTFIHOVQYYAMH-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O6 |
|---|---|
| Molecular weight | 246.56 g/mol |
| IUPAC name | 4-chloro-3,5-dinitrobenzoic acid |
| InChIKey | PCTFIHOVQYYAMH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)