CAS 95192-57-7 appears in our catalog under these names: 4-Chloro-2,6-dinitrobenzoic Acid, ≥95%, ≥95%, 4-Chloro-2,6-dinitrobenzoic acid, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4-chloro-2,6-dinitrobenzoic acid (CAS 95192-57-7) is a chemical compound with the molecular formula C7H3ClN2O6 and a molecular weight of 246.56 g/mol. IUPAC name: 4-chloro-2,6-dinitrobenzoic acid. InChIKey: GQWMLRJMEVDSOK-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O6 |
|---|---|
| Molecular weight | 246.56 g/mol |
| IUPAC name | 4-chloro-2,6-dinitrobenzoic acid |
| InChIKey | GQWMLRJMEVDSOK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])C(=O)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)