CAS 2497-91-8 appears in our catalog under these names: 2-Chloro-3,5-dinitrobenzoic acid, 97%, 2-chloro-3,5-dinitrobenzoic acid, 2–chloro–3,5–dinitrobenzoic Acid, 2-Chloro-3,5-dinitrobenzoic acid, 97% (dry wt.), may cont. u, 2-Chloro-3,5-dinitrobenzoic acid, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 100g, 1kg, 500g, 25g, 5g, on request, 250g.
2-chloro-3,5-dinitrobenzoic acid (CAS 2497-91-8) is a chemical compound with the molecular formula C7H3ClN2O6 and a molecular weight of 246.56 g/mol. IUPAC name: 2-chloro-3,5-dinitrobenzoic acid. InChIKey: ADTKEYLCJYYHHH-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O6 |
|---|---|
| Molecular weight | 246.56 g/mol |
| IUPAC name | 2-chloro-3,5-dinitrobenzoic acid |
| InChIKey | ADTKEYLCJYYHHH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)