CAS 118000-52-5 is the registry number for 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzonitrile (CAS 118000-52-5) is a chemical compound with the molecular formula C15H11N3 and a molecular weight of 233.27 g/mol. IUPAC name: 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzonitrile. InChIKey: URUGTBXSBNZLKJ-UHFFFAOYSA-N.
| Molecular formula | C15H11N3 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzonitrile |
| InChIKey | URUGTBXSBNZLKJ-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C2C=C1)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)