CAS 1403483-59-9 is the registry number for 1-Benzyl-1,3-benzodiazole-5-carbonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-benzylbenzimidazole-5-carbonitrile (CAS 1403483-59-9) is a chemical compound with the molecular formula C15H11N3 and a molecular weight of 233.27 g/mol. IUPAC name: 1-benzylbenzimidazole-5-carbonitrile. InChIKey: SWFRAEKHPOTJGL-UHFFFAOYSA-N.
| Molecular formula | C15H11N3 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | 1-benzylbenzimidazole-5-carbonitrile |
| InChIKey | SWFRAEKHPOTJGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC3=C2C=CC(=C3)C#N |
Computed by PubChem (NCBI)