CAS 1898-74-4 appears in our catalog under these names: 4-(2-Aminopropyl)-2-methoxyphenol, 98%, 98%, 2,4-Diphenyl-1,3,5-triazine, 97%, 2,4-Diphenyl-1,3,5-triazine, 98%. Offered by: Chemat, Chemat Brand, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, on request, 5g.
2,4-diphenyl-1,3,5-triazine (CAS 1898-74-4) is a chemical compound with the molecular formula C15H11N3 and a molecular weight of 233.27 g/mol. IUPAC name: 2,4-diphenyl-1,3,5-triazine. InChIKey: OTJZMNIBLUCUJZ-UHFFFAOYSA-N.
| Molecular formula | C15H11N3 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | 2,4-diphenyl-1,3,5-triazine |
| InChIKey | OTJZMNIBLUCUJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)