CAS 118001-60-8 is the registry number for 4-(3-Methylimidazo[1,2-a]pyridin-2-yl)benzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-methylimidazo[1,2-a]pyridin-2-yl)benzaldehyde (CAS 118001-60-8) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: 4-(3-methylimidazo[1,2-a]pyridin-2-yl)benzaldehyde. InChIKey: NFLQQTQJBSDHPL-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 4-(3-methylimidazo[1,2-a]pyridin-2-yl)benzaldehyde |
| InChIKey | NFLQQTQJBSDHPL-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2N1C=CC=C2)C3=CC=C(C=C3)C=O |
Computed by PubChem (NCBI)