CAS 118026-14-5 appears in our catalog under these names: alpha-Hydroxy Zolpidem, Zolpidem tartrate Impurity 17, Zolpidem Impurity 13, alpha-Hydroxyzolpidem. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[2-hydroxy-6-methyl-2-(4-methylphenyl)-3H-imidazo[1,2-a]pyridin-3-yl]-N,N-dimethylacetamide (CAS 118026-14-5) is a chemical compound with the molecular formula C19H23N3O2 and a molecular weight of 325.4 g/mol. IUPAC name: 2-[2-hydroxy-6-methyl-2-(4-methylphenyl)-3H-imidazo[1,2-a]pyridin-3-yl]-N,N-dimethylacetamide. InChIKey: VLHJPCWGOSLMQL-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2-[2-hydroxy-6-methyl-2-(4-methylphenyl)-3H-imidazo[1,2-a]pyridin-3-yl]-N,N-dimethylacetamide |
| InChIKey | VLHJPCWGOSLMQL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(C(N3C=C(C=CC3=N2)C)CC(=O)N(C)C)O |
Computed by PubChem (NCBI)