Products 537034-15-4
CAS 537034-15-4 appears in our catalog under these names: Nkl 22, 95%, N-(2-Aminophenyl)-N’-phenylheptanediamide, >95% (HPLC), NKL 22, NKL 22, NKL 22 95%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 10mg, 25mg, 50mg, 200mg, 5mg.
N'-(2-aminophenyl)-N-phenylheptanediamide (CAS 537034-15-4) is a chemical compound with the molecular formula C19H23N3O2 and a molecular weight of 325.4 g/mol. IUPAC name: N'-(2-aminophenyl)-N-phenylheptanediamide. InChIKey: ZAIULUYKQLVQFH-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | N'-(2-aminophenyl)-N-phenylheptanediamide |
| InChIKey | ZAIULUYKQLVQFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)CCCCCC(=O)NC2=CC=CC=C2N |
Computed by PubChem (NCBI)