CAS 36504-71-9 appears in our catalog under these names: Benzydamine N-Oxide, >95% (HPLC), Benzydamine N–Oxide, Benzydamine N-oxide, 3-((1-Benzyl-1H-indazol-3-yl)oxy)-N,N-dimethylpropan-1-amine oxide, 95%, 95%, Benzydamine N-Oxide, 98.90%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 1mg, 2mg, 1 mg.
3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide (CAS 36504-71-9) is a chemical compound with the molecular formula C19H23N3O2 and a molecular weight of 325.4 g/mol. IUPAC name: 3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide. InChIKey: VHKKEFPZHPEYJK-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide |
| InChIKey | VHKKEFPZHPEYJK-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCCOC1=NN(C2=CC=CC=C21)CC3=CC=CC=C3)[O-] |
Computed by PubChem (NCBI)