CAS 1180497-48-6 appears in our catalog under these names: Methyl 2-amino-3-fluoro-4-methoxybenzoate, 95%, Methyl 2-amino-3-fluoro-4-methoxybenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
Methyl 2-amino-3-fluoro-4-methoxybenzoate (CAS 1180497-48-6) is a chemical compound with the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. IUPAC name: methyl 2-amino-3-fluoro-4-methoxybenzoate. InChIKey: UBKIXHUPQNDLCP-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO3 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | methyl 2-amino-3-fluoro-4-methoxybenzoate |
| InChIKey | UBKIXHUPQNDLCP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)OC)N)F |
Computed by PubChem (NCBI)