CAS 1181267-43-5 is the registry number for 2-Methanesulfonyl-2,7-diazaspiro[4.4]nonane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-methylsulfonyl-2,7-diazaspiro[4.4]nonane (CAS 1181267-43-5) is a chemical compound with the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. IUPAC name: 2-methylsulfonyl-2,7-diazaspiro[4.4]nonane. InChIKey: CYDOCMAHBGNXTF-UHFFFAOYSA-N.
| Molecular formula | C8H16N2O2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 2-methylsulfonyl-2,7-diazaspiro[4.4]nonane |
| InChIKey | CYDOCMAHBGNXTF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC2(C1)CCNC2 |
Computed by PubChem (NCBI)