CAS 1604418-55-4 is the registry number for (3S)-1-(Cyclopropanesulfonyl)-3-methylpiperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(3S)-1-cyclopropylsulfonyl-3-methylpiperazine (CAS 1604418-55-4) is a chemical compound with the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. IUPAC name: (3S)-1-cyclopropylsulfonyl-3-methylpiperazine. InChIKey: HGZFARXELQZEDC-ZETCQYMHSA-N.
| Molecular formula | C8H16N2O2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | (3S)-1-cyclopropylsulfonyl-3-methylpiperazine |
| InChIKey | HGZFARXELQZEDC-ZETCQYMHSA-N |
| SMILES | C[C@H]1CN(CCN1)S(=O)(=O)C2CC2 |
Computed by PubChem (NCBI)