Products 1544363-38-3

CAS 1544363-38-3 is the registry number for 4-(3-Aminopropyl)thiomorpholine-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(3-aminopropyl)thiomorpholine-3-carboxylic acid (CAS 1544363-38-3) is a chemical compound with the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. IUPAC name: 4-(3-aminopropyl)thiomorpholine-3-carboxylic acid. InChIKey: VWJDMHNIEDRYLA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16N2O2S
Molecular weight204.29 g/mol
IUPAC name4-(3-aminopropyl)thiomorpholine-3-carboxylic acid
InChIKeyVWJDMHNIEDRYLA-UHFFFAOYSA-N
SMILESC1CSCC(N1CCCN)C(=O)O

Computed by PubChem (NCBI)