Products 1181320-54-6
CAS 1181320-54-6 is the registry number for 3'-(Dimethylamino)biphenyl-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[3-(dimethylamino)phenyl]benzoic acid (CAS 1181320-54-6) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 3-[3-(dimethylamino)phenyl]benzoic acid. InChIKey: IGKUVSHRCBIVKZ-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 3-[3-(dimethylamino)phenyl]benzoic acid |
| InChIKey | IGKUVSHRCBIVKZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC(=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)