Products 1181457-86-2

CAS 1181457-86-2 is the registry number for 4-tert-Butyl-n-methylcyclohexan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 25g, 1g.

Structural formula: {0} (CAS {1})

4-tert-butyl-N-methylcyclohexan-1-amine;hydrochloride (CAS 1181457-86-2) is a chemical compound with the molecular formula C11H24ClN and a molecular weight of 205.77 g/mol. IUPAC name: 4-tert-butyl-N-methylcyclohexan-1-amine;hydrochloride. InChIKey: PDYXNLBBCOSYCK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H24ClN
Molecular weight205.77 g/mol
IUPAC name4-tert-butyl-N-methylcyclohexan-1-amine;hydrochloride
InChIKeyPDYXNLBBCOSYCK-UHFFFAOYSA-N
SMILESCC(C)(C)C1CCC(CC1)NC.Cl

Computed by PubChem (NCBI)