CAS 219835-66-2 appears in our catalog under these names: (3,3,5,5-Tetramethylcyclohexyl)methanamine hydrochloride, 95%, (3,3,5,5-Tetramethylcyclohexyl)methanamine hydrochloride, (3,3,5,5-TETRAMETHYLCYCLOHEXYL)METHANAMINE HCL, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg.
(3,3,5,5-tetramethylcyclohexyl)methanamine;hydrochloride (CAS 219835-66-2) is a chemical compound with the molecular formula C11H24ClN and a molecular weight of 205.77 g/mol. IUPAC name: (3,3,5,5-tetramethylcyclohexyl)methanamine;hydrochloride. InChIKey: SSJNMFPQWNHVBU-UHFFFAOYSA-N.
| Molecular formula | C11H24ClN |
|---|---|
| Molecular weight | 205.77 g/mol |
| IUPAC name | (3,3,5,5-tetramethylcyclohexyl)methanamine;hydrochloride |
| InChIKey | SSJNMFPQWNHVBU-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(C1)(C)C)CN)C.Cl |
Computed by PubChem (NCBI)