CAS 1807912-11-3 is the registry number for 4-tert-Butyl-2,6-dimethylpiperidine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R,6S)-4-tert-butyl-2,6-dimethylpiperidine;hydrochloride (CAS 1807912-11-3) is a chemical compound with the molecular formula C11H24ClN and a molecular weight of 205.77 g/mol. IUPAC name: (2R,6S)-4-tert-butyl-2,6-dimethylpiperidine;hydrochloride. InChIKey: PAOMDOCSDKCOKD-CVLICLBHSA-N.
| Molecular formula | C11H24ClN |
|---|---|
| Molecular weight | 205.77 g/mol |
| IUPAC name | (2R,6S)-4-tert-butyl-2,6-dimethylpiperidine;hydrochloride |
| InChIKey | PAOMDOCSDKCOKD-CVLICLBHSA-N |
| SMILES | C[C@@H]1CC(C[C@@H](N1)C)C(C)(C)C.Cl |
Computed by PubChem (NCBI)