Products 1181458-23-0
CAS 1181458-23-0 is the registry number for 3-{(3-(Trifluoromethyl)phenyl)methyl}azetidine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[[3-(trifluoromethyl)phenyl]methyl]azetidine;hydrochloride (CAS 1181458-23-0) is a chemical compound with the molecular formula C11H13ClF3N and a molecular weight of 251.67 g/mol. IUPAC name: 3-[[3-(trifluoromethyl)phenyl]methyl]azetidine;hydrochloride. InChIKey: BSXVAANDDFNBOL-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3N |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | 3-[[3-(trifluoromethyl)phenyl]methyl]azetidine;hydrochloride |
| InChIKey | BSXVAANDDFNBOL-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CC2=CC(=CC=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)