Products 1181623-64-2
CAS 1181623-64-2 is the registry number for 1-(2,6-Dichlorophenyl)-5-oxopyrrolidine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,6-dichlorophenyl)-5-oxopyrrolidine-3-carbonitrile (CAS 1181623-64-2) is a chemical compound with the molecular formula C11H8Cl2N2O and a molecular weight of 255.10 g/mol. IUPAC name: 1-(2,6-dichlorophenyl)-5-oxopyrrolidine-3-carbonitrile. InChIKey: OCTCREFCCVYHAW-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | 1-(2,6-dichlorophenyl)-5-oxopyrrolidine-3-carbonitrile |
| InChIKey | OCTCREFCCVYHAW-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=C(C=CC=C2Cl)Cl)C#N |
Computed by PubChem (NCBI)