Products 1181635-27-7

CAS 1181635-27-7 is the registry number for 2-Hydroxy-3-(4-isopropylphenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-hydroxy-3-(4-propan-2-ylphenyl)propanoic acid (CAS 1181635-27-7) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2-hydroxy-3-(4-propan-2-ylphenyl)propanoic acid. InChIKey: CEPHNDIROZUJAT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O3
Molecular weight208.25 g/mol
IUPAC name2-hydroxy-3-(4-propan-2-ylphenyl)propanoic acid
InChIKeyCEPHNDIROZUJAT-UHFFFAOYSA-N
SMILESCC(C)C1=CC=C(C=C1)CC(C(=O)O)O

Computed by PubChem (NCBI)