CAS 1181669-11-3 is the registry number for 2-Methyl-4-phenyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-4-phenyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (CAS 1181669-11-3) is a chemical compound with the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. IUPAC name: 2-methyl-4-phenyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine. InChIKey: QJMQWZRIRWAJGD-UHFFFAOYSA-N.
| Molecular formula | C14H15N3 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | 2-methyl-4-phenyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| InChIKey | QJMQWZRIRWAJGD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(CNCC2)C(=N1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)