CAS 247939-84-0 is the registry number for Frovatriptan Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
(6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carbonitrile (CAS 247939-84-0) is a chemical compound with the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. IUPAC name: (6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carbonitrile. InChIKey: WPDCBQPOJXEMKM-SNVBAGLBSA-N.
| Molecular formula | C14H15N3 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | (6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carbonitrile |
| InChIKey | WPDCBQPOJXEMKM-SNVBAGLBSA-N |
| SMILES | CN[C@@H]1CCC2=C(C1)C3=C(N2)C=CC(=C3)C#N |
Computed by PubChem (NCBI)